![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| APS2003.pdf | 2004-04-15 21:09 | 845K | |
| IMPACT2003.pdf | 2004-04-15 21:08 | 724K | |
| ISAM2003Pumactant.pdf | 2004-04-15 20:01 | 271K | |
| AAPS2003Begat.pdf | 2004-04-15 19:57 | 238K | |
| IEEE (Characterization of the surface physico-chemical stability of materials directly applicable to inhalation therapy).pdf | 2004-04-15 19:56 | 539K | |
| Raman-EAFS.pdf | 2004-04-15 19:55 | 329K | |
| AAPS2003Etched.pdf | 2004-04-15 19:52 | 304K | |
| AAPS2003Amorphous.pdf | 2004-04-15 19:52 | 252K | |
| AAPS2003RapidScreening.pdf | 2004-04-15 19:51 | 228K | |